C11H18O3S2 — CID 11207748
(3aR,4S,6aR)-4-(1,3-dithian-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 11207748) has the molecular formula C11H18O3S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is (3aR,4S,6aR)-4-(1,3-dithian-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4S,6aR)-4-(1,3-dithian-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 11207748 |
| Molecular Formula | C11H18O3S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | (3aR,4S,6aR)-4-(1,3-dithian-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2[C@@H](C3SCCCS3)OC[C@H]2O1 |
| InChI | InChI=1S/C11H18O3S2/c1-11(2)13-7-6-12-9(8(7)14-11)10-15-4-3-5-16-10/h7-10H,3-6H2,1-2H3/t7-,8-,9+/m1/s1 |
| InChIKey | ALELWVCKFQYLQK-HLTSFMKQSA-N |
| XLogP | 2.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |