C11H18O4S — CID 538718
4,4,11,11-tetramethyl-3,5,10,12-tetraoxa-7-thiatricyclo[6.4.0.02,6]dodecane (PubChem CID 538718) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is 4,4,11,11-tetramethyl-3,5,10,12-tetraoxa-7-thiatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 4,4,11,11-tetramethyl-3,5,10,12-tetraoxa-7-thiatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 538718 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4,4,11,11-tetramethyl-3,5,10,12-tetraoxa-7-thiatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1(C)OCC2SC3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C11H18O4S/c1-10(2)12-5-6-7(13-10)8-9(16-6)15-11(3,4)14-8/h6-9H,5H2,1-4H3 |
| InChIKey | JAJRGYYUYZRTMF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |