C9H12O4S2 — CID 139051896
(1R,2R,6R,8S)-4,4-dimethyl-3,5,7,12-tetraoxa-10-thiatricyclo[6.4.0.02,6]dodecane-11-thione (PubChem CID 139051896) has the molecular formula C9H12O4S2 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1R,2R,6R,8S)-4,4-dimethyl-3,5,7,12-tetraoxa-10-thiatricyclo[6.4.0.02,6]dodecane-11-thione.
| Compound Name | (1R,2R,6R,8S)-4,4-dimethyl-3,5,7,12-tetraoxa-10-thiatricyclo[6.4.0.02,6]dodecane-11-thione |
|---|---|
| PubChem CID | 139051896 |
| Molecular Formula | C9H12O4S2 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | (1R,2R,6R,8S)-4,4-dimethyl-3,5,7,12-tetraoxa-10-thiatricyclo[6.4.0.02,6]dodecane-11-thione |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CSC(=S)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C9H12O4S2/c1-9(2)12-6-5-4(10-7(6)13-9)3-15-8(14)11-5/h4-7H,3H2,1-2H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | QYFBIPHRJWFJTA-XZBKPIIZSA-N |
| XLogP | 1.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|