C11H20O5S — CID 11000063
(3aR,5S,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-5-[methylsulfanyl(ditritio)methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 11000063) has the molecular formula C11H20O5S and a molecular weight of 268.36 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-5-[methylsulfanyl(ditritio)methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5S,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-5-[methylsulfanyl(ditritio)methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 11000063 |
| Molecular Formula | C11H20O5S |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3aR,5S,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-5-[methylsulfanyl(ditritio)methyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | [3H]C([3H])(SC)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OCOC |
| InChI | InChI=1S/C11H20O5S/c1-11(2)15-9-8(13-6-12-3)7(5-17-4)14-10(9)16-11/h7-10H,5-6H2,1-4H3/t7-,8-,9-,10-/m1/s1/i5T2 |
| InChIKey | DDVMLDRPVNYDLR-WNMRRMNSSA-N |
| XLogP | 1.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|