C14H24O4S2 — CID 134974732
(4S,5R)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 134974732) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (4S,5R)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134974732 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (4S,5R)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(1,3-dithian-2-yl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H]([C@@H]2OC(C)(C)O[C@H]2C2SCCCS2)O1 |
| InChI | InChI=1S/C14H24O4S2/c1-13(2)15-8-9(16-13)10-11(18-14(3,4)17-10)12-19-6-5-7-20-12/h9-12H,5-8H2,1-4H3/t9-,10-,11+/m0/s1 |
| InChIKey | DYZJEYMHAXWGNK-GARJFASQSA-N |
| XLogP | 2.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |