C14H24O7S — CID 134927930
(1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-8-propylsulfonyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 134927930) has the molecular formula C14H24O7S and a molecular weight of 336.41 g/mol. Its IUPAC name is (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-8-propylsulfonyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-8-propylsulfonyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 134927930 |
| Molecular Formula | C14H24O7S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-8-propylsulfonyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CCCS(=O)(=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H24O7S/c1-6-7-22(15,16)12-10-8(18-13(2,3)20-10)9-11(17-12)21-14(4,5)19-9/h8-12H,6-7H2,1-5H3/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | ZTNKNGWYCFMAIZ-LZQZFOIKSA-N |
| XLogP | 1.17 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |