C12H22O6S — CID 102392910
(3aR,4R,6R,6aS)-4-methoxy-2,2-dimethyl-6-(propan-2-ylsulfonylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 102392910) has the molecular formula C12H22O6S and a molecular weight of 294.37 g/mol. Its IUPAC name is (3aR,4R,6R,6aS)-4-methoxy-2,2-dimethyl-6-(propan-2-ylsulfonylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4R,6R,6aS)-4-methoxy-2,2-dimethyl-6-(propan-2-ylsulfonylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 102392910 |
| Molecular Formula | C12H22O6S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (3aR,4R,6R,6aS)-4-methoxy-2,2-dimethyl-6-(propan-2-ylsulfonylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CO[C@@H]1O[C@@H](CS(=O)(=O)C(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H22O6S/c1-7(2)19(13,14)6-8-9-10(11(15-5)16-8)18-12(3,4)17-9/h7-11H,6H2,1-5H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | ZZGZHZRLPBUOAM-LNFKQOIKSA-N |
| XLogP | 0.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |