C19H34O7S — CID 134929109
(1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-8-octylsulfonyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 134929109) has the molecular formula C19H34O7S and a molecular weight of 406.54 g/mol. Its IUPAC name is (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-8-octylsulfonyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-8-octylsulfonyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 134929109 |
| Molecular Formula | C19H34O7S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (1R,2R,6S,8R,9R)-4,4,11,11-tetramethyl-8-octylsulfonyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CCCCCCCCS(=O)(=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C19H34O7S/c1-6-7-8-9-10-11-12-27(20,21)17-15-13(23-18(2,3)25-15)14-16(22-17)26-19(4,5)24-14/h13-17H,6-12H2,1-5H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | QNGDCAXNWCNZSJ-WRQOLXDDSA-N |
| XLogP | 3.12 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|