C13H22O7S — CID 10903364
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(methylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 10903364) has the molecular formula C13H22O7S and a molecular weight of 322.38 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(methylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(methylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 10903364 |
| Molecular Formula | C13H22O7S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-8-(methylsulfonylmethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CS(C)(=O)=O)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H22O7S/c1-12(2)17-8-7(6-21(5,14)15)16-11-10(9(8)18-12)19-13(3,4)20-11/h7-11H,6H2,1-5H3/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | PWGULKQTVSWDOB-ZKKRXERASA-N |
| XLogP | 0.43 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |