C15H24O9S — CID 11760682
methyl 2-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfonyl]acetate (PubChem CID 11760682) has the molecular formula C15H24O9S and a molecular weight of 380.42 g/mol. Its IUPAC name is methyl 2-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfonyl]acetate.
| Compound Name | methyl 2-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfonyl]acetate |
|---|---|
| PubChem CID | 11760682 |
| Molecular Formula | C15H24O9S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | methyl 2-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfonyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H24O9S/c1-14(2)21-10-8(6-25(17,18)7-9(16)19-5)20-13-12(11(10)22-14)23-15(3,4)24-13/h8,10-13H,6-7H2,1-5H3/t8-,10+,11+,12-,13-/m1/s1 |
| InChIKey | QJUSZHVFQWWXDC-UUWLPUTASA-N |
| XLogP | -0.03 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |