C16H24O9S — CID 134878552
[(5R,6R,7S,7aR)-6,7-diacetyloxy-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate (PubChem CID 134878552) has the molecular formula C16H24O9S and a molecular weight of 392.43 g/mol. Its IUPAC name is [(5R,6R,7S,7aR)-6,7-diacetyloxy-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate.
| Compound Name | [(5R,6R,7S,7aR)-6,7-diacetyloxy-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 134878552 |
| Molecular Formula | C16H24O9S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [(5R,6R,7S,7aR)-6,7-diacetyloxy-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl acetate |
| SMILES | CCSC1(C)OC2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2O1 |
| InChI | InChI=1S/C16H24O9S/c1-6-26-16(5)24-14-13(22-10(4)19)12(21-9(3)18)11(7-20-8(2)17)23-15(14)25-16/h11-15H,6-7H2,1-5H3/t11-,12-,13+,14-,15?,16?/m1/s1 |
| InChIKey | XGJNUILTHMFUPZ-SPGNZJCFSA-N |
| XLogP | 0.98 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|