C14H20O9 — CID 5231228
(6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl)methyl acetate (PubChem CID 5231228) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is (6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl)methyl acetate.
| Compound Name | (6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl)methyl acetate |
|---|---|
| PubChem CID | 5231228 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC2OC(C)OC2C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H20O9/c1-6(15)18-5-10-11(19-7(2)16)12(20-8(3)17)13-14(23-10)22-9(4)21-13/h9-14H,5H2,1-4H3 |
| InChIKey | NBWFYJVPTWVPKZ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|