C13H19NO5S — CID 100968131
[(1R,2S,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl thiocyanate (PubChem CID 100968131) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is [(1R,2S,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl thiocyanate.
| Compound Name | [(1R,2S,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 100968131 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [(1R,2S,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl thiocyanate |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(CSC#N)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C13H19NO5S/c1-11(2)16-8-5-15-13(6-20-7-14)10(9(8)17-11)18-12(3,4)19-13/h8-10H,5-6H2,1-4H3/t8-,9-,10+,13+/m1/s1 |
| InChIKey | KRQJEOWOTZJWNA-DNJQJEMRSA-N |
| XLogP | 1.60 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|