C14H24O6S — CID 134843022
(3'aR,4S,7'S,7'aR)-2,2,2',2'-tetramethyl-7'-(methylsulfanylmethoxy)spiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] (PubChem CID 134843022) has the molecular formula C14H24O6S and a molecular weight of 320.41 g/mol. Its IUPAC name is (3'aR,4S,7'S,7'aR)-2,2,2',2'-tetramethyl-7'-(methylsulfanylmethoxy)spiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran].
| Compound Name | (3'aR,4S,7'S,7'aR)-2,2,2',2'-tetramethyl-7'-(methylsulfanylmethoxy)spiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] |
|---|---|
| PubChem CID | 134843022 |
| Molecular Formula | C14H24O6S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (3'aR,4S,7'S,7'aR)-2,2,2',2'-tetramethyl-7'-(methylsulfanylmethoxy)spiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran] |
| SMILES | CSCO[C@H]1[C@@H]2OC(C)(C)O[C@@H]2CO[C@]12COC(C)(C)O2 |
| InChI | InChI=1S/C14H24O6S/c1-12(2)17-7-14(20-12)11(15-8-21-5)10-9(6-16-14)18-13(3,4)19-10/h9-11H,6-8H2,1-5H3/t9-,10-,11+,14+/m1/s1 |
| InChIKey | OVWWJEZVSROOQY-PUHVVEEASA-N |
| XLogP | 1.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|