C11H20O2S — CID 134992485
(3aS,4R,6R,6aS)-4,6-diethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole (PubChem CID 134992485) has the molecular formula C11H20O2S and a molecular weight of 216.35 g/mol. Its IUPAC name is (3aS,4R,6R,6aS)-4,6-diethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4R,6R,6aS)-4,6-diethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 134992485 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3aS,4R,6R,6aS)-4,6-diethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
| SMILES | CC[C@H]1S[C@H](CC)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C11H20O2S/c1-5-7-9-10(8(6-2)14-7)13-11(3,4)12-9/h7-10H,5-6H2,1-4H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | WWLDXZQQOPECLN-ZYUZMQFOSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |