C8H15O2S+ — CID 140854908
2,2,5-trimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-5-ium (PubChem CID 140854908) has the molecular formula C8H15O2S+ and a molecular weight of 175.27 g/mol. Its IUPAC name is 2,2,5-trimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-5-ium.
| Compound Name | 2,2,5-trimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-5-ium |
|---|---|
| PubChem CID | 140854908 |
| Molecular Formula | C8H15O2S+ |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2,2,5-trimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-5-ium |
| SMILES | C[S+]1CC2OC(C)(C)OC2C1 |
| InChI | InChI=1S/C8H15O2S/c1-8(2)9-6-4-11(3)5-7(6)10-8/h6-7H,4-5H2,1-3H3/q+1 |
| InChIKey | KTJQWCTXCNZARM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|