About 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide
2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide (PubChem CID 282952) has the molecular formula C7H12O4S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide.
Analyze 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide?
The IUPAC name of 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide (CID 282952) is 2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide.
What is the SMILES notation for 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide?
The canonical SMILES for 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide is CC1(OC2CS(=O)(=O)CC2O1)C.
What is the InChIKey of 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide?
The InChIKey is AUVAYKUAZKEFGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4S/c1-7(2)10-5-3-12(8,9)4-6(5)11-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide?
2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide has a molecular weight of 192.24 g/mol, XLogP of -0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-Dimethyltetrahydrothieno[3,4-d][1,3]dioxole 5,5-dioxide is sourced from PubChem (CID 282952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).