About 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane
2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane (PubChem CID 130747223) has the molecular formula C9H16O3S
and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane.
Analyze 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane?
The IUPAC name of 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane (CID 130747223) is 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane.
What is the SMILES notation for 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane?
The canonical SMILES for 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane is CC1OCCC1SCC1OCCO1.
What is the InChIKey of 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane?
The InChIKey is JEODNXMLWJZESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3S/c1-7-8(2-3-10-7)13-6-9-11-4-5-12-9/h7-9H,2-6H2,1H3.
What are the key properties of 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane?
2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane has a molecular weight of 204.29 g/mol, XLogP of 1.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-1,3-dioxolane is sourced from PubChem (CID 130747223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).