C9H16N2O2 — CID 130643461
(2R)-N-(1-cyano-2,2-dimethylpropyl)-2-hydroxypropanamide (PubChem CID 130643461) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (2R)-N-(1-cyano-2,2-dimethylpropyl)-2-hydroxypropanamide.
| Compound Name | (2R)-N-(1-cyano-2,2-dimethylpropyl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 130643461 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (2R)-N-(1-cyano-2,2-dimethylpropyl)-2-hydroxypropanamide |
| SMILES | C[C@@H](O)C(=O)NC(C#N)C(C)(C)C |
| InChI | InChI=1S/C9H16N2O2/c1-6(12)8(13)11-7(5-10)9(2,3)4/h6-7,12H,1-4H3,(H,11,13)/t6-,7?/m1/s1 |
| InChIKey | VBKCMMPRXAMPEW-ULUSZKPHSA-N |
| XLogP | 0.42 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |