C10H18N2O2 — CID 139881772
N-(2-cyano-3,3-dimethylbutan-2-yl)-2-hydroxypropanamide (PubChem CID 139881772) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N-(2-cyano-3,3-dimethylbutan-2-yl)-2-hydroxypropanamide.
| Compound Name | N-(2-cyano-3,3-dimethylbutan-2-yl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 139881772 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-(2-cyano-3,3-dimethylbutan-2-yl)-2-hydroxypropanamide |
| SMILES | CC(O)C(=O)NC(C)(C#N)C(C)(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-7(13)8(14)12-10(5,6-11)9(2,3)4/h7,13H,1-5H3,(H,12,14) |
| InChIKey | UZHZAKGJYNEEKK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |