C9H16N2O2 — CID 18700272
N-(2-cyano-3-methylbutan-2-yl)-2-hydroxypropanamide (PubChem CID 18700272) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N-(2-cyano-3-methylbutan-2-yl)-2-hydroxypropanamide.
| Compound Name | N-(2-cyano-3-methylbutan-2-yl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 18700272 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-(2-cyano-3-methylbutan-2-yl)-2-hydroxypropanamide |
| SMILES | CC(O)C(=O)NC(C)(C#N)C(C)C |
| InChI | InChI=1S/C9H16N2O2/c1-6(2)9(4,5-10)11-8(13)7(3)12/h6-7,12H,1-4H3,(H,11,13) |
| InChIKey | LEZJIYDWHLRMGV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |