C15H17Cl3N2O2 — CID 67880923
N-(2-cyano-3-methylbutan-2-yl)-2-(2,3,4-trichlorophenoxy)propanamide (PubChem CID 67880923) has the molecular formula C15H17Cl3N2O2 and a molecular weight of 363.67 g/mol. Its IUPAC name is N-(2-cyano-3-methylbutan-2-yl)-2-(2,3,4-trichlorophenoxy)propanamide.
| Compound Name | N-(2-cyano-3-methylbutan-2-yl)-2-(2,3,4-trichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 67880923 |
| Molecular Formula | C15H17Cl3N2O2 |
| Molecular Weight | 363.67 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | N-(2-cyano-3-methylbutan-2-yl)-2-(2,3,4-trichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)c(Cl)c1Cl)C(=O)NC(C)(C#N)C(C)C |
| InChI | InChI=1S/C15H17Cl3N2O2/c1-8(2)15(4,7-19)20-14(21)9(3)22-11-6-5-10(16)12(17)13(11)18/h5-6,8-9H,1-4H3,(H,20,21) |
| InChIKey | UQRVSJGTWGYEKX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|