C7H10O3 — CID 130643878
(4R)-4-hydroxy-2-(hydroxymethyl)-4-methylcyclopent-2-en-1-one (PubChem CID 130643878) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (4R)-4-hydroxy-2-(hydroxymethyl)-4-methylcyclopent-2-en-1-one.
| Compound Name | (4R)-4-hydroxy-2-(hydroxymethyl)-4-methylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 130643878 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (4R)-4-hydroxy-2-(hydroxymethyl)-4-methylcyclopent-2-en-1-one |
| SMILES | C[C@]1(O)C=C(CO)C(=O)C1 |
| InChI | InChI=1S/C7H10O3/c1-7(10)2-5(4-8)6(9)3-7/h2,8,10H,3-4H2,1H3/t7-/m0/s1 |
| InChIKey | PXYQBOLVWOVXSF-ZETCQYMHSA-N |
| XLogP | -0.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |