C11H17FN2 — CID 130647256
1-(5-fluoro-2-pyridinyl)-2,3-dimethylbutan-1-amine (PubChem CID 130647256) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-2,3-dimethylbutan-1-amine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 130647256 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-2,3-dimethylbutan-1-amine |
| SMILES | CC(C)C(C)C(N)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H17FN2/c1-7(2)8(3)11(13)10-5-4-9(12)6-14-10/h4-8,11H,13H2,1-3H3 |
| InChIKey | UEEZCGJQMQPNHK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |