C11H16FN — CID 59539521
2-[(2S)-3,3-dimethylbutan-2-yl]-5-fluoropyridine (PubChem CID 59539521) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 2-[(2S)-3,3-dimethylbutan-2-yl]-5-fluoropyridine.
| Compound Name | 2-[(2S)-3,3-dimethylbutan-2-yl]-5-fluoropyridine |
|---|---|
| PubChem CID | 59539521 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-[(2S)-3,3-dimethylbutan-2-yl]-5-fluoropyridine |
| SMILES | C[C@H](c1ccc(F)cn1)C(C)(C)C |
| InChI | InChI=1S/C11H16FN/c1-8(11(2,3)4)10-6-5-9(12)7-13-10/h5-8H,1-4H3/t8-/m1/s1 |
| InChIKey | OASJOUWPJJEQDB-MRVPVSSYSA-N |
| XLogP | 3.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |