C11H17FN2OS — CID 68561497
N-[1-(5-fluoro-2-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 68561497) has the molecular formula C11H17FN2OS and a molecular weight of 244.33 g/mol. Its IUPAC name is N-[1-(5-fluoro-2-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(5-fluoro-2-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 68561497 |
| Molecular Formula | C11H17FN2OS |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-[1-(5-fluoro-2-pyridinyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(NS(=O)C(C)(C)C)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H17FN2OS/c1-8(14-16(15)11(2,3)4)10-6-5-9(12)7-13-10/h5-8,14H,1-4H3 |
| InChIKey | BAWJTWRNDKQESC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |