C12H19FN2O3S2 — CID 68946827
N-[1-(5-fluoro-2-pyridinyl)-2-methylsulfonylethyl]-2-methylpropane-2-sulfinamide (PubChem CID 68946827) has the molecular formula C12H19FN2O3S2 and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[1-(5-fluoro-2-pyridinyl)-2-methylsulfonylethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(5-fluoro-2-pyridinyl)-2-methylsulfonylethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 68946827 |
| Molecular Formula | C12H19FN2O3S2 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[1-(5-fluoro-2-pyridinyl)-2-methylsulfonylethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(CS(C)(=O)=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H19FN2O3S2/c1-12(2,3)19(16)15-11(8-20(4,17)18)10-6-5-9(13)7-14-10/h5-7,11,15H,8H2,1-4H3 |
| InChIKey | DLHGAJCFRGMOSZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |