C13H27N — CID 130647932
4,4-dimethyl-1-(3-methylbutan-2-yl)cyclohexan-1-amine (PubChem CID 130647932) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is 4,4-dimethyl-1-(3-methylbutan-2-yl)cyclohexan-1-amine.
| Compound Name | 4,4-dimethyl-1-(3-methylbutan-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 130647932 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 4,4-dimethyl-1-(3-methylbutan-2-yl)cyclohexan-1-amine |
| SMILES | CC(C)C(C)C1(N)CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H27N/c1-10(2)11(3)13(14)8-6-12(4,5)7-9-13/h10-11H,6-9,14H2,1-5H3 |
| InChIKey | UFXFARLCIOSVOA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |