C24H28ClN3O4 — CID 13064836
6-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butanoyl]-3,4-dihydro-1H-quinolin-2-one;hydrochloride (PubChem CID 13064836) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is 6-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butanoyl]-3,4-dihydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | 6-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butanoyl]-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 13064836 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 6-[4-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]butanoyl]-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| SMILES | Cl.O=C1CCc2cc(C(=O)CCCN3CCN(c4ccc5c(c4)OCO5)CC3)ccc2N1 |
| InChI | InChI=1S/C24H27N3O4.ClH/c28-21(18-3-6-20-17(14-18)4-8-24(29)25-20)2-1-9-26-10-12-27(13-11-26)19-5-7-22-23(15-19)31-16-30-22;/h3,5-7,14-15H,1-2,4,8-13,16H2,(H,25,29);1H |
| InChIKey | SFHKPBSUMAWFAL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|