C11H15N3 — CID 130649548
N'-methyl-N'-(3-pyridin-3-ylprop-2-ynyl)ethane-1,2-diamine (PubChem CID 130649548) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N'-methyl-N'-(3-pyridin-3-ylprop-2-ynyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(3-pyridin-3-ylprop-2-ynyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130649548 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N'-methyl-N'-(3-pyridin-3-ylprop-2-ynyl)ethane-1,2-diamine |
| SMILES | CN(CC#Cc1cccnc1)CCN |
| InChI | InChI=1S/C11H15N3/c1-14(9-6-12)8-3-5-11-4-2-7-13-10-11/h2,4,7,10H,6,8-9,12H2,1H3 |
| InChIKey | OFRRFBVLZPEQJL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|