C13H23NO — CID 130649723
[(1S,2R)-2-(aminomethyl)cyclopentyl]-cyclohexylmethanone (PubChem CID 130649723) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is [(1S,2R)-2-(aminomethyl)cyclopentyl]-cyclohexylmethanone.
| Compound Name | [(1S,2R)-2-(aminomethyl)cyclopentyl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 130649723 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | [(1S,2R)-2-(aminomethyl)cyclopentyl]-cyclohexylmethanone |
| SMILES | NC[C@@H]1CCC[C@@H]1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H23NO/c14-9-11-7-4-8-12(11)13(15)10-5-2-1-3-6-10/h10-12H,1-9,14H2/t11-,12-/m0/s1 |
| InChIKey | UQRMGOHIKRDOGG-RYUDHWBXSA-N |
| XLogP | 2.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |