C9H12N2OS — CID 130650634
N-(thiophen-3-ylmethyl)azetidine-1-carboxamide (PubChem CID 130650634) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)azetidine-1-carboxamide.
| Compound Name | N-(thiophen-3-ylmethyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 130650634 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-(thiophen-3-ylmethyl)azetidine-1-carboxamide |
| SMILES | O=C(NCc1ccsc1)N1CCC1 |
| InChI | InChI=1S/C9H12N2OS/c12-9(11-3-1-4-11)10-6-8-2-5-13-7-8/h2,5,7H,1,3-4,6H2,(H,10,12) |
| InChIKey | PVPVEJDVLQPFKO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |