C10H21NOS — CID 130651968
3-methyl-4-(3-methylbutyl)-1,4-thiazinane 1-oxide (PubChem CID 130651968) has the molecular formula C10H21NOS and a molecular weight of 203.35 g/mol. Its IUPAC name is 3-methyl-4-(3-methylbutyl)-1,4-thiazinane 1-oxide.
| Compound Name | 3-methyl-4-(3-methylbutyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 130651968 |
| Molecular Formula | C10H21NOS |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-methyl-4-(3-methylbutyl)-1,4-thiazinane 1-oxide |
| SMILES | CC(C)CCN1CCS(=O)CC1C |
| InChI | InChI=1S/C10H21NOS/c1-9(2)4-5-11-6-7-13(12)8-10(11)3/h9-10H,4-8H2,1-3H3 |
| InChIKey | QHWCKNHXSCACCA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |