C8H17NO2S — CID 130775734
3-(3-methyl-1-oxo-1,4-thiazinan-4-yl)propan-1-ol (PubChem CID 130775734) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is 3-(3-methyl-1-oxo-1,4-thiazinan-4-yl)propan-1-ol.
| Compound Name | 3-(3-methyl-1-oxo-1,4-thiazinan-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 130775734 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 3-(3-methyl-1-oxo-1,4-thiazinan-4-yl)propan-1-ol |
| SMILES | CC1CS(=O)CCN1CCCO |
| InChI | InChI=1S/C8H17NO2S/c1-8-7-12(11)6-4-9(8)3-2-5-10/h8,10H,2-7H2,1H3 |
| InChIKey | CEXITTLDBPFAPJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |