C5H11N5O2S — CID 130652208
(2S)-2-[(carbamothioylamino)carbamoylamino]propanamide (PubChem CID 130652208) has the molecular formula C5H11N5O2S and a molecular weight of 205.24 g/mol. Its IUPAC name is (2S)-2-[(carbamothioylamino)carbamoylamino]propanamide.
| Compound Name | (2S)-2-[(carbamothioylamino)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 130652208 |
| Molecular Formula | C5H11N5O2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (2S)-2-[(carbamothioylamino)carbamoylamino]propanamide |
| SMILES | C[C@H](NC(=O)NNC(N)=S)C(N)=O |
| InChI | InChI=1S/C5H11N5O2S/c1-2(3(6)11)8-5(12)10-9-4(7)13/h2H,1H3,(H2,6,11)(H3,7,9,13)(H2,8,10,12)/t2-/m0/s1 |
| InChIKey | JRPKGIAJZKVELM-REOHCLBHSA-N |
| XLogP | -2.09 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|