About 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol
1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol (PubChem CID 130654817) has the molecular formula C7H10ClNOS
and a molecular weight of 191.68 g/mol. Its IUPAC name is 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol |
| PubChem CID | 130654817 |
| Molecular Formula | C7H10ClNOS |
| Molecular Weight | 191.68 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol |
| SMILES | Cc1cc(CC(O)CCl)sn1 |
| InChI | InChI=1S/C7H10ClNOS/c1-5-2-7(11-9-5)3-6(10)4-8/h2,6,10H,3-4H2,1H3 |
| InChIKey | YQFROANKKOUHDN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.68 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol?
The IUPAC name of 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol (CID 130654817) is 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol.
What is the SMILES notation for 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol?
The canonical SMILES for 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol is Cc1cc(CC(O)CCl)sn1.
What is the InChIKey of 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol?
The InChIKey is YQFROANKKOUHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClNOS/c1-5-2-7(11-9-5)3-6(10)4-8/h2,6,10H,3-4H2,1H3.
What are the key properties of 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol?
1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol has a molecular weight of 191.68 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(3-methyl-1,2-thiazol-5-yl)propan-2-ol is sourced from PubChem (CID 130654817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).