C10H17NOS — CID 130656094
3,3-dimethyl-2-(3-methyl-1,2-thiazol-5-yl)butan-2-ol (PubChem CID 130656094) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is 3,3-dimethyl-2-(3-methyl-1,2-thiazol-5-yl)butan-2-ol.
| Compound Name | 3,3-dimethyl-2-(3-methyl-1,2-thiazol-5-yl)butan-2-ol |
|---|---|
| PubChem CID | 130656094 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3,3-dimethyl-2-(3-methyl-1,2-thiazol-5-yl)butan-2-ol |
| SMILES | Cc1cc(C(C)(O)C(C)(C)C)sn1 |
| InChI | InChI=1S/C10H17NOS/c1-7-6-8(13-11-7)10(5,12)9(2,3)4/h6,12H,1-5H3 |
| InChIKey | JATIAJKXGBGXBL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |