C9H12N4O — CID 130657687
4-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]but-2-yn-1-ol (PubChem CID 130657687) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]but-2-yn-1-ol.
| Compound Name | 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]but-2-yn-1-ol |
|---|---|
| PubChem CID | 130657687 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]but-2-yn-1-ol |
| SMILES | Cc1nnc(NCC#CCO)nc1C |
| InChI | InChI=1S/C9H12N4O/c1-7-8(2)12-13-9(11-7)10-5-3-4-6-14/h14H,5-6H2,1-2H3,(H,10,11,13) |
| InChIKey | IRYARBHFPSMIKX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|