C7H15ClN2O3 — CID 130657923
(2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride (PubChem CID 130657923) has the molecular formula C7H15ClN2O3 and a molecular weight of 210.66 g/mol. Its IUPAC name is (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 130657923 |
| Molecular Formula | C7H15ClN2O3 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CONC(=O)[C@@H]1C[C@H](OC)CN1.Cl |
| InChI | InChI=1S/C7H14N2O3.ClH/c1-11-5-3-6(8-4-5)7(10)9-12-2;/h5-6,8H,3-4H2,1-2H3,(H,9,10);1H/t5-,6-;/m0./s1 |
| InChIKey | QYCBUIGPJWQTJV-GEMLJDPKSA-N |
| XLogP | -0.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|