About (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride
(2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride (PubChem CID 130657923) has the molecular formula C7H15ClN2O3
and a molecular weight of 210.66 g/mol. Its IUPAC name is (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride |
| PubChem CID | 130657923 |
| Molecular Formula | C7H15ClN2O3 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CONC(=O)[C@@H]1C[C@H](OC)CN1.Cl |
| InChI | InChI=1S/C7H14N2O3.ClH/c1-11-5-3-6(8-4-5)7(10)9-12-2;/h5-6,8H,3-4H2,1-2H3,(H,9,10);1H/t5-,6-;/m0./s1 |
| InChIKey | QYCBUIGPJWQTJV-GEMLJDPKSA-N |
| XLogP | -0.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride?
The IUPAC name of (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride (CID 130657923) is (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride.
What is the SMILES notation for (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride?
The canonical SMILES for (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride is CONC(=O)[C@@H]1C[C@H](OC)CN1.Cl.
What is the InChIKey of (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride?
The InChIKey is QYCBUIGPJWQTJV-GEMLJDPKSA-N. The full InChI is InChI=1S/C7H14N2O3.ClH/c1-11-5-3-6(8-4-5)7(10)9-12-2;/h5-6,8H,3-4H2,1-2H3,(H,9,10);1H/t5-,6-;/m0./s1.
What are the key properties of (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride?
(2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride has a molecular weight of 210.66 g/mol, XLogP of -0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-N,4-dimethoxypyrrolidine-2-carboxamide;hydrochloride is sourced from PubChem (CID 130657923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).