C9H17N3O4 — CID 83209217
2-[(4-methoxypyrrolidine-2-carbonyl)amino]ethyl carbamate (PubChem CID 83209217) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[(4-methoxypyrrolidine-2-carbonyl)amino]ethyl carbamate.
| Compound Name | 2-[(4-methoxypyrrolidine-2-carbonyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83209217 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2-[(4-methoxypyrrolidine-2-carbonyl)amino]ethyl carbamate |
| SMILES | COC1CNC(C(=O)NCCOC(N)=O)C1 |
| InChI | InChI=1S/C9H17N3O4/c1-15-6-4-7(12-5-6)8(13)11-2-3-16-9(10)14/h6-7,12H,2-5H2,1H3,(H2,10,14)(H,11,13) |
| InChIKey | BAKCMKSDESOWBW-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|