C9H11N5 — CID 130658671
N-[2-(1H-pyrazol-4-yl)ethyl]pyridazin-3-amine (PubChem CID 130658671) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is N-[2-(1H-pyrazol-4-yl)ethyl]pyridazin-3-amine.
| Compound Name | N-[2-(1H-pyrazol-4-yl)ethyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 130658671 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[2-(1H-pyrazol-4-yl)ethyl]pyridazin-3-amine |
| SMILES | c1cnnc(NCCc2cn[nH]c2)c1 |
| InChI | InChI=1S/C9H11N5/c1-2-9(14-11-4-1)10-5-3-8-6-12-13-7-8/h1-2,4,6-7H,3,5H2,(H,10,14)(H,12,13) |
| InChIKey | PCLIYIPQCOYAJD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |