C13H15N3 — CID 79034324
N-[2-(2-methylphenyl)ethyl]pyridazin-3-amine (PubChem CID 79034324) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[2-(2-methylphenyl)ethyl]pyridazin-3-amine.
| Compound Name | N-[2-(2-methylphenyl)ethyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 79034324 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[2-(2-methylphenyl)ethyl]pyridazin-3-amine |
| SMILES | Cc1ccccc1CCNc1cccnn1 |
| InChI | InChI=1S/C13H15N3/c1-11-5-2-3-6-12(11)8-10-14-13-7-4-9-15-16-13/h2-7,9H,8,10H2,1H3,(H,14,16) |
| InChIKey | UKEFAIPMHWABEK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |