C4H4F2N2S2 — CID 130658941
2-(2,2-difluoroethylsulfanyl)-1,3,4-thiadiazole (PubChem CID 130658941) has the molecular formula C4H4F2N2S2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(2,2-difluoroethylsulfanyl)-1,3,4-thiadiazole.
| Compound Name | 2-(2,2-difluoroethylsulfanyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130658941 |
| Molecular Formula | C4H4F2N2S2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 181.98 |
| IUPAC Name | 2-(2,2-difluoroethylsulfanyl)-1,3,4-thiadiazole |
| SMILES | FC(F)CSc1nncs1 |
| InChI | InChI=1S/C4H4F2N2S2/c5-3(6)1-9-4-8-7-2-10-4/h2-3H,1H2 |
| InChIKey | QGKVSIMYWBSOAK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |