C10H14N2OS — CID 130659099
6-ethoxy-N-(thietan-3-yl)pyridin-2-amine (PubChem CID 130659099) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 6-ethoxy-N-(thietan-3-yl)pyridin-2-amine.
| Compound Name | 6-ethoxy-N-(thietan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 130659099 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 6-ethoxy-N-(thietan-3-yl)pyridin-2-amine |
| SMILES | CCOc1cccc(NC2CSC2)n1 |
| InChI | InChI=1S/C10H14N2OS/c1-2-13-10-5-3-4-9(12-10)11-8-6-14-7-8/h3-5,8H,2,6-7H2,1H3,(H,11,12) |
| InChIKey | LXPJTUABILFIHR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |