C6H8F2N4O — CID 130660783
N-(2,2-difluoroethyl)-3-methyltriazole-4-carboxamide (PubChem CID 130660783) has the molecular formula C6H8F2N4O and a molecular weight of 190.15 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-methyltriazole-4-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-3-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 130660783 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-methyltriazole-4-carboxamide |
| SMILES | Cn1nncc1C(=O)NCC(F)F |
| InChI | InChI=1S/C6H8F2N4O/c1-12-4(2-10-11-12)6(13)9-3-5(7)8/h2,5H,3H2,1H3,(H,9,13) |
| InChIKey | IQMHCULELGQFPB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |