C8H11N3O — CID 130664887
3-[(1S)-1-amino-3-hydroxypropyl]-1H-pyrrole-2-carbonitrile (PubChem CID 130664887) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 3-[(1S)-1-amino-3-hydroxypropyl]-1H-pyrrole-2-carbonitrile.
| Compound Name | 3-[(1S)-1-amino-3-hydroxypropyl]-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 130664887 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 3-[(1S)-1-amino-3-hydroxypropyl]-1H-pyrrole-2-carbonitrile |
| SMILES | N#Cc1[nH]ccc1[C@@H](N)CCO |
| InChI | InChI=1S/C8H11N3O/c9-5-8-6(1-3-11-8)7(10)2-4-12/h1,3,7,11-12H,2,4,10H2/t7-/m0/s1 |
| InChIKey | UAIBKXFYRXDCDV-ZETCQYMHSA-N |
| XLogP | 0.27 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |