About 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine
1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine (PubChem CID 130667085) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine.
Analyze 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine?
The IUPAC name of 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine (CID 130667085) is 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine.
What is the SMILES notation for 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine?
The canonical SMILES for 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine is CCN(C)C1CN(C2CC2)CC1C.
What is the InChIKey of 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine?
The InChIKey is JTHOYUNERGKRCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-4-12(3)11-8-13(7-9(11)2)10-5-6-10/h9-11H,4-8H2,1-3H3.
What are the key properties of 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine?
1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine has a molecular weight of 182.31 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N-ethyl-N,4-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 130667085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).