C11H21NO — CID 170614269
1-cyclobutyl-3,5-dimethylpiperidin-4-ol (PubChem CID 170614269) has the molecular formula C11H21NO and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-cyclobutyl-3,5-dimethylpiperidin-4-ol.
| Compound Name | 1-cyclobutyl-3,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 170614269 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-cyclobutyl-3,5-dimethylpiperidin-4-ol |
| SMILES | CC1CN(C2CCC2)CC(C)C1O |
| InChI | InChI=1S/C11H21NO/c1-8-6-12(10-4-3-5-10)7-9(2)11(8)13/h8-11,13H,3-7H2,1-2H3 |
| InChIKey | VAUCJRQAPMDAEF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |