C7H11NO2 — CID 130668490
N-ethyl-2,3-dihydrofuran-5-carboxamide (PubChem CID 130668490) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is N-ethyl-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-ethyl-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130668490 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | N-ethyl-2,3-dihydrofuran-5-carboxamide |
| SMILES | CCNC(=O)C1=CCCO1 |
| InChI | InChI=1S/C7H11NO2/c1-2-8-7(9)6-4-3-5-10-6/h4H,2-3,5H2,1H3,(H,8,9) |
| InChIKey | BZAUUHWCLCGFTB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |