About (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate
(1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate (PubChem CID 130670080) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate |
| PubChem CID | 130670080 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate |
| SMILES | C[C@@H](O)C(=O)Oc1cnn(C)c1 |
| InChI | InChI=1S/C7H10N2O3/c1-5(10)7(11)12-6-3-8-9(2)4-6/h3-5,10H,1-2H3/t5-/m1/s1 |
| InChIKey | UUBOYYLMGVKUHA-RXMQYKEDSA-N |
| XLogP | -0.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate?
The IUPAC name of (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate (CID 130670080) is (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate.
What is the SMILES notation for (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate?
The canonical SMILES for (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate is C[C@@H](O)C(=O)Oc1cnn(C)c1.
What is the InChIKey of (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate?
The InChIKey is UUBOYYLMGVKUHA-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5(10)7(11)12-6-3-8-9(2)4-6/h3-5,10H,1-2H3/t5-/m1/s1.
What are the key properties of (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate?
(1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate has a molecular weight of 170.17 g/mol, XLogP of -0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazol-4-yl) (2R)-2-hydroxypropanoate is sourced from PubChem (CID 130670080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).